CAS 23165-60-8 appears in our catalog under these names: 4-Methoxy-2-nitrophenyl isothiocyanate, 95%, Esomeprazole Impurity 71, Esomeprazole Impurity 61, 4–Methoxy–2–nitrophenyl isothiocyanate. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, GLPBio. Available pack sizes: 1g, 5g, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-isothiocyanato-4-methoxy-2-nitrobenzene (CAS 23165-60-8) is a chemical compound with the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. IUPAC name: 1-isothiocyanato-4-methoxy-2-nitrobenzene. InChIKey: YVARXELMRLSEEG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 1-isothiocyanato-4-methoxy-2-nitrobenzene |
| InChIKey | YVARXELMRLSEEG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N=C=S)[N+](=O)[O-] |
Computed by PubChem (NCBI)