CAS 23190-16-1 appears in our catalog under these names: (1R,2S)-(-)-2-Amino-1,2-diphenylethanol, 97%, (1R,2S)-(-)-2-Amino-1,2-diphenylethanol, (1R,2S)–(–)–2–Amino–1,2–diphenylethanol, (1R,2S)-(-)-2-Amino-1,2-diphenylethanol, 99%, (1R,2S)-(-)-2-Amino-1,2-diphenylethanol, >99.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 500g, 5g, 25g, 250g, 1g, 50g, 1kg.
(1R,2S)-2-amino-1,2-diphenylethanol (CAS 23190-16-1) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: (1R,2S)-2-amino-1,2-diphenylethanol. InChIKey: GEJJWYZZKKKSEV-UONOGXRCSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (1R,2S)-2-amino-1,2-diphenylethanol |
| InChIKey | GEJJWYZZKKKSEV-UONOGXRCSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@@H](C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)