CAS 23364-44-5 appears in our catalog under these names: (1S,2R)-(+)-2-Amino-1,2-diphenylethanol, 98%, (1S,2R)–(+)–2–Amino–1,2–diphenylethanol, (1S,2R)-(+)-2-Amino-1,2-diphenylethanol, 98% , (1S,2R)-(+)-2-Amino-1,2-diphenylethanol, (1S,2R)-2-Amino-1,2-diphenylethanol, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 25g, 1g, 5g, 100g, 500g, 10g, 50g, 250g.
(1S,2R)-2-amino-1,2-diphenylethanol (CAS 23364-44-5) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: (1S,2R)-2-amino-1,2-diphenylethanol. InChIKey: GEJJWYZZKKKSEV-KGLIPLIRSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (1S,2R)-2-amino-1,2-diphenylethanol |
| InChIKey | GEJJWYZZKKKSEV-KGLIPLIRSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@H](C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)