CAS 23190-17-2 appears in our catalog under these names: (S,S)-(-)-2-AMINO-1,2-DIPHENYLETHANOL, (S,S)-2-Amino-1,2-diphenyl-1-ethanol, 97%, 97%, (1S,2S)-2-Amino-1,2-diphenylethan-1-ol, 97%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 500MG, 100mg, 250mg, 1g, 5g.
(1S,2S)-2-amino-1,2-diphenylethanol (CAS 23190-17-2) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: (1S,2S)-2-amino-1,2-diphenylethanol. InChIKey: GEJJWYZZKKKSEV-KBPBESRZSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (1S,2S)-2-amino-1,2-diphenylethanol |
| InChIKey | GEJJWYZZKKKSEV-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)