CAS 88082-66-0 appears in our catalog under these names: (R,R)-(+)-2-Amino-1,2-diphenylethanol, 97%, 97%, (1R,2R)-2-Amino-1,2-diphenylethanol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R,2R)-2-amino-1,2-diphenylethanol (CAS 88082-66-0) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: (1R,2R)-2-amino-1,2-diphenylethanol. InChIKey: GEJJWYZZKKKSEV-ZIAGYGMSSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (1R,2R)-2-amino-1,2-diphenylethanol |
| InChIKey | GEJJWYZZKKKSEV-ZIAGYGMSSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)