Products 2320344-36-1
CAS 2320344-36-1 is the registry number for 4-(1,1-Dimethylethyl) 1-methyl 2-oxobicyclo[2.2.2]octane-1,4-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-O-tert-butyl 1-O-methyl 2-oxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS 2320344-36-1) is a chemical compound with the molecular formula C15H22O5 and a molecular weight of 282.33 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl 2-oxobicyclo[2.2.2]octane-1,4-dicarboxylate. InChIKey: ZZJAGUCZKRRLLI-UHFFFAOYSA-N.
| Molecular formula | C15H22O5 |
|---|---|
| Molecular weight | 282.33 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl 2-oxobicyclo[2.2.2]octane-1,4-dicarboxylate |
| InChIKey | ZZJAGUCZKRRLLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CCC(CC1)(C(=O)C2)C(=O)OC |
Computed by PubChem (NCBI)