CAS 57144-06-6 appears in our catalog under these names: Testosterone EP Impurity J, Testosterone Impurity 10(Testosterone EP Impurity J), 3-Methoxy Androsta-3,5-dien-17-one (1mg/ml in Acetonitrile), 3-Methoxy Androsta-3,5-dien-17-one, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5x1ml, 250mg.
(8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (CAS 57144-06-6) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one. InChIKey: WSIQEGIPGPEMTC-TXTPUJOMSA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | WSIQEGIPGPEMTC-TXTPUJOMSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CCC(=C4)OC)C |
Computed by PubChem (NCBI)