CAS 4954-14-7 appears in our catalog under these names: Estradiol Impurity 8, 17b-Estradiol Dimethyl Ether, >95% (HPLC), 17beta-Estradiol Dimethyl Ether, >95% (HPLC), 17'-Estradiol dimethyl ether. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
(8R,9S,13S,14S,17S)-3-methoxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (CAS 4954-14-7) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-3-methoxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol. InChIKey: AZQAIRJYCUWZPD-SLHNCBLASA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-3-methoxy-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| InChIKey | AZQAIRJYCUWZPD-SLHNCBLASA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CCC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)