CAS 23222-97-1 appears in our catalog under these names: (2-Nitro-1,4-phenylene)dimethanol, 97%, 2-Nitro-p-xylylene glycol, 95%, 2–Nitro–p–xylylene Glycol, 2-Nitro-p-xylylene Glycol, >95.0%(GC), (2-Nitro-1,4-phenylene)dimethanol, 98%, 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
[4-(hydroxymethyl)-3-nitrophenyl]methanol (CAS 23222-97-1) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: [4-(hydroxymethyl)-3-nitrophenyl]methanol. InChIKey: KWVHOBYJXDKIPL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | [4-(hydroxymethyl)-3-nitrophenyl]methanol |
| InChIKey | KWVHOBYJXDKIPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)