CAS 2322690-83-3 appears in our catalog under these names: (S)-1,3,7-Triazaspiro(4.5)decane-2,4-dione, 95%, (5S)-1,3,9-triazaspiro[4.5]decane-2,4-dione, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
(5S)-1,3,9-triazaspiro[4.5]decane-2,4-dione (CAS 2322690-83-3) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (5S)-1,3,9-triazaspiro[4.5]decane-2,4-dione. InChIKey: PLFDWSDBRBNQLQ-ZETCQYMHSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (5S)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| InChIKey | PLFDWSDBRBNQLQ-ZETCQYMHSA-N |
| SMILES | C1C[C@]2(CNC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)