Products 2791275-79-9
CAS 2791275-79-9 is the registry number for (5R)-1,3,9-triazaspiro[4.5]decane-2,4-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(5R)-1,3,9-triazaspiro[4.5]decane-2,4-dione (CAS 2791275-79-9) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (5R)-1,3,9-triazaspiro[4.5]decane-2,4-dione. InChIKey: PLFDWSDBRBNQLQ-SSDOTTSWSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (5R)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| InChIKey | PLFDWSDBRBNQLQ-SSDOTTSWSA-N |
| SMILES | C1C[C@@]2(CNC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)