CAS 2323068-93-3 is the registry number for (S)-1-Boc-4-(1-Hydroxy-2-propyl)piperazine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl 4-[(2S)-1-hydroxypropan-2-yl]piperazine-1-carboxylate (CAS 2323068-93-3) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl 4-[(2S)-1-hydroxypropan-2-yl]piperazine-1-carboxylate. InChIKey: OLQYUDUDNCDQPU-JTQLQIEISA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl 4-[(2S)-1-hydroxypropan-2-yl]piperazine-1-carboxylate |
| InChIKey | OLQYUDUDNCDQPU-JTQLQIEISA-N |
| SMILES | C[C@@H](CO)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)