Products 23241-07-8
CAS 23241-07-8 is the registry number for 4b-Methylbenzo(4,5)thiazolo(2,3-a)isoindol-11(4bH)-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
4b-methylisoindolo[1,2-b][1,3]benzothiazol-11-one (CAS 23241-07-8) is a chemical compound with the molecular formula C15H11NOS and a molecular weight of 253.32 g/mol. IUPAC name: 4b-methylisoindolo[1,2-b][1,3]benzothiazol-11-one. InChIKey: QZTVCLSTRYYRAR-UHFFFAOYSA-N.
| Molecular formula | C15H11NOS |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 4b-methylisoindolo[1,2-b][1,3]benzothiazol-11-one |
| InChIKey | QZTVCLSTRYYRAR-UHFFFAOYSA-N |
| SMILES | CC12C3=CC=CC=C3C(=O)N1C4=CC=CC=C4S2 |
Computed by PubChem (NCBI)