CAS 59484-42-3 is the registry number for 2,5-Diphenyl-1,3-thiazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,5-diphenyl-1,3-thiazol-4-ol (CAS 59484-42-3) is a chemical compound with the molecular formula C15H11NOS and a molecular weight of 253.32 g/mol. IUPAC name: 2,5-diphenyl-1,3-thiazol-4-ol. InChIKey: HICCJUZMDNQOMI-UHFFFAOYSA-N.
| Molecular formula | C15H11NOS |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2,5-diphenyl-1,3-thiazol-4-ol |
| InChIKey | HICCJUZMDNQOMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)