CAS 416859-97-7 appears in our catalog under these names: 4-(4-Phenyl-1,3-thiazol-2-yl)phenol, 95%, 4-(4-Phenyl-1,3-thiazol-2-yl)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-(4-phenyl-1,3-thiazol-2-yl)phenol (CAS 416859-97-7) is a chemical compound with the molecular formula C15H11NOS and a molecular weight of 253.32 g/mol. IUPAC name: 4-(4-phenyl-1,3-thiazol-2-yl)phenol. InChIKey: DKXVVPYNEPDZNT-UHFFFAOYSA-N.
| Molecular formula | C15H11NOS |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 4-(4-phenyl-1,3-thiazol-2-yl)phenol |
| InChIKey | DKXVVPYNEPDZNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)