CAS 56071-71-7 appears in our catalog under these names: 2-(Benzo(d)thiazol-2-yl)-1-phenylethanone, 97%, 2-(1,3-Benzothiazol-2-yl)-1-phenylethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
2-(1,3-benzothiazol-2-yl)-1-phenylethanone (CAS 56071-71-7) is a chemical compound with the molecular formula C15H11NOS and a molecular weight of 253.32 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-1-phenylethanone. InChIKey: WOBXNQIHAIRCIN-UHFFFAOYSA-N.
| Molecular formula | C15H11NOS |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-1-phenylethanone |
| InChIKey | WOBXNQIHAIRCIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)