CAS 23245-77-4 is the registry number for [4,4'-Bipyridine]-3,3'-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-carboxy-4-pyridinyl)pyridine-3-carboxylic acid (CAS 23245-77-4) is a chemical compound with the molecular formula C12H8N2O4 and a molecular weight of 244.20 g/mol. IUPAC name: 4-(3-carboxy-4-pyridinyl)pyridine-3-carboxylic acid. InChIKey: MIAMXHQVTYLVSJ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 4-(3-carboxy-4-pyridinyl)pyridine-3-carboxylic acid |
| InChIKey | MIAMXHQVTYLVSJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=C(C=NC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)