Products 232590-81-7
CAS 232590-81-7 is the registry number for Salbutamol Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(tert-butylamino)-hydroxymethyl]-2-(hydroxymethyl)phenol (CAS 232590-81-7) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: 4-[(tert-butylamino)-hydroxymethyl]-2-(hydroxymethyl)phenol. InChIKey: QCNDGAHIHMKWHD-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 4-[(tert-butylamino)-hydroxymethyl]-2-(hydroxymethyl)phenol |
| InChIKey | QCNDGAHIHMKWHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(C1=CC(=C(C=C1)O)CO)O |
Computed by PubChem (NCBI)