Products 2329045-07-8
CAS 2329045-07-8 appears in our catalog under these names: ethyl trans–1–benzyl–4–(3，4–dimethoxyphenyl)pyrrolidine–3–carboxylate, ethyl trans-1-benzyl-4-(3，4-dimethoxyphenyl)pyrrolidine-3-carboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
Ethyl (3R,4S)-1-benzyl-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate (CAS 2329045-07-8) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: ethyl (3R,4S)-1-benzyl-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate. InChIKey: ADNFAVNLFMNUOZ-MOPGFXCFSA-N.
| Molecular formula | C22H27NO4 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | ethyl (3R,4S)-1-benzyl-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylate |
| InChIKey | ADNFAVNLFMNUOZ-MOPGFXCFSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1C2=CC(=C(C=C2)OC)OC)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)