CAS 2332707-65-8 appears in our catalog under these names: SODIUM-L-LACTATE-2-D1, >= 98 ATOM % D&, Sodium L-lactate-2-d1. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 50MG.
Sodium 2-deuterio-2-hydroxypropanoate (CAS 2332707-65-8) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 113.07 g/mol. IUPAC name: sodium 2-deuterio-2-hydroxypropanoate. InChIKey: NGSFWBMYFKHRBD-YPAXDSTQSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 113.07 g/mol |
| IUPAC name | sodium 2-deuterio-2-hydroxypropanoate |
| InChIKey | NGSFWBMYFKHRBD-YPAXDSTQSA-M |
| SMILES | [2H]C(C)(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)