CAS 2334105-13-2 is the registry number for Punicagaranine. Offered by: TRC. Available pack sizes: 25mg.
3-(furan-2-carbonyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylic acid (CAS 2334105-13-2) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 3-(furan-2-carbonyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylic acid. InChIKey: VTEXWWBYSBRMMO-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 3-(furan-2-carbonyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylic acid |
| InChIKey | VTEXWWBYSBRMMO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(N2C1)C(=O)C3=CC=CO3)C(=O)O |
Computed by PubChem (NCBI)