CAS 233600-52-7 is the registry number for Hydroxybupropion (as (RS,RS)-cyclic Hemiketal). Offered by: Mikromol, LoGiCal. Available pack sizes: 25mg, 10mg.
(2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol (CAS 233600-52-7) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol. InChIKey: RCOBKSKAZMVBHT-TVQRCGJNSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol |
| InChIKey | RCOBKSKAZMVBHT-TVQRCGJNSA-N |
| SMILES | C[C@H]1[C@@](OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)