Products 2337008-64-5
CAS 2337008-64-5 is the registry number for 5-HT7R antagonist 1 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane (CAS 2337008-64-5) is a chemical compound with the molecular formula C14H17ClN4 and a molecular weight of 276.76 g/mol. IUPAC name: 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane. InChIKey: QYUZYZBBJGTSFR-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN4 |
|---|---|
| Molecular weight | 276.76 g/mol |
| IUPAC name | 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane |
| InChIKey | QYUZYZBBJGTSFR-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(NN=C2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)