CAS 86627-50-1 is the registry number for Lodinixil. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-4-N-(2,3-dimethylphenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (CAS 86627-50-1) is a chemical compound with the molecular formula C14H17ClN4 and a molecular weight of 276.76 g/mol. IUPAC name: 6-chloro-4-N-(2,3-dimethylphenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine. InChIKey: GMMWNTHAIOJBSD-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN4 |
|---|---|
| Molecular weight | 276.76 g/mol |
| IUPAC name | 6-chloro-4-N-(2,3-dimethylphenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| InChIKey | GMMWNTHAIOJBSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=CC(=NC(=N2)N(C)C)Cl)C |
Computed by PubChem (NCBI)