Products 233756-76-8
CAS 233756-76-8 is the registry number for 4-((Tert-Butoxycarbonyl)Oxy)Benzoic Acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid (CAS 233756-76-8) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid. InChIKey: KVNNDSUUTJORDP-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid |
| InChIKey | KVNNDSUUTJORDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)