CAS 2340-22-9 is the registry number for 3,3,3-Trifluoro-1-phenylpropan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3,3-trifluoro-1-phenylpropan-1-ol (CAS 2340-22-9) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 3,3,3-trifluoro-1-phenylpropan-1-ol. InChIKey: FGQDXXGWOGKGBU-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-phenylpropan-1-ol |
| InChIKey | FGQDXXGWOGKGBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(F)(F)F)O |
Computed by PubChem (NCBI)