Products 2340294-58-6
CAS 2340294-58-6 is the registry number for 2-(Naphthalen-1-yl)oxazole-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-naphthalen-1-yl-1,3-oxazole-4-carbonitrile (CAS 2340294-58-6) is a chemical compound with the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. IUPAC name: 2-naphthalen-1-yl-1,3-oxazole-4-carbonitrile. InChIKey: QREIKJOKXXNGHX-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 2-naphthalen-1-yl-1,3-oxazole-4-carbonitrile |
| InChIKey | QREIKJOKXXNGHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC(=CO3)C#N |
Computed by PubChem (NCBI)