CAS 2717-05-7 is the registry number for 11H-Benzo[4,5]imidazo[2,1-a]isoindol-11-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Isoindolo[2,3-a]benzimidazol-11-one (CAS 2717-05-7) is a chemical compound with the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. IUPAC name: isoindolo[2,3-a]benzimidazol-11-one. InChIKey: SDLWGEXLAMKZHI-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | isoindolo[2,3-a]benzimidazol-11-one |
| InChIKey | SDLWGEXLAMKZHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC4=CC=CC=C4N3C2=O |
Computed by PubChem (NCBI)