CAS 6508-04-9 appears in our catalog under these names: 4-Cyanophenyl ether, 95%, Bis(4-cyanophenyl) Ether, >98.0%(GC), 4-Cyanophenyl ether, 4,4'-Oxydibenzonitrile, 98%+(GC-MS),RG, 98%+(GC-MS),RG. Offered by: Combi-blocks, TCI, Fluorochem, Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
4-(4-cyanophenoxy)benzonitrile (CAS 6508-04-9) is a chemical compound with the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. IUPAC name: 4-(4-cyanophenoxy)benzonitrile. InChIKey: RSAUOQFEFINEDM-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 4-(4-cyanophenoxy)benzonitrile |
| InChIKey | RSAUOQFEFINEDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)