CAS 313366-70-0 is the registry number for 2-Cyano-4-(4-cyanophenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4-cyanophenyl)-2-hydroxybenzonitrile (CAS 313366-70-0) is a chemical compound with the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. IUPAC name: 5-(4-cyanophenyl)-2-hydroxybenzonitrile. InChIKey: HSXFHKWCOPMRIQ-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 5-(4-cyanophenyl)-2-hydroxybenzonitrile |
| InChIKey | HSXFHKWCOPMRIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(C=C2)O)C#N |
Computed by PubChem (NCBI)