Products 2342594-39-0
CAS 2342594-39-0 is the registry number for Methyl 2-[[(1,1-dimethylethoxy)carbonyl]oxy]-5-(1,1-dimethylethyl)benzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (CAS 2342594-39-0) is a chemical compound with the molecular formula C17H24O5 and a molecular weight of 308.4 g/mol. IUPAC name: methyl 5-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate. InChIKey: WQCFBZVNRKOKEE-UHFFFAOYSA-N.
| Molecular formula | C17H24O5 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | methyl 5-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| InChIKey | WQCFBZVNRKOKEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)