CAS 2344678-47-1 is the registry number for 6-Methoxy-4-methyl-2,3-dihydro-1H-indole-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-methoxy-4-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 2344678-47-1) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 6-methoxy-4-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: IRHAXVWBNJYFJO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 6-methoxy-4-methyl-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | IRHAXVWBNJYFJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1CC(N2)C(=O)O)OC.Cl |
Computed by PubChem (NCBI)