Products 2344680-66-4
CAS 2344680-66-4 is the registry number for 2-Methoxy-N1,N1-dimethylbenzene-1,4-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride (CAS 2344680-66-4) is a chemical compound with the molecular formula C9H16Cl2N2O and a molecular weight of 239.14 g/mol. IUPAC name: 2-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride. InChIKey: BPRYRMNBVBCGJR-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2O |
|---|---|
| Molecular weight | 239.14 g/mol |
| IUPAC name | 2-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | BPRYRMNBVBCGJR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)OC.Cl.Cl |
Computed by PubChem (NCBI)