Products 2344685-95-4
CAS 2344685-95-4 is the registry number for 5-(Propan-2-yl)-4H,5H,6H,7H-(1,2)oxazolo(4,5-c)pyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-propan-2-yl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxylic acid;hydrochloride (CAS 2344685-95-4) is a chemical compound with the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. IUPAC name: 5-propan-2-yl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxylic acid;hydrochloride. InChIKey: QUYZZVFYKZUXDQ-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O3 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 5-propan-2-yl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | QUYZZVFYKZUXDQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC2=C(C1)C(=NO2)C(=O)O.Cl |
Computed by PubChem (NCBI)