Products 2260937-29-7

CAS 2260937-29-7 is the registry number for Methyl 5-(piperidin-3-yl)-1,3-oxazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-piperidin-3-yl-1,3-oxazole-4-carboxylate;hydrochloride (CAS 2260937-29-7) is a chemical compound with the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 5-piperidin-3-yl-1,3-oxazole-4-carboxylate;hydrochloride. InChIKey: RDGKCHUZQLSGNN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O3
Molecular weight246.69 g/mol
IUPAC namemethyl 5-piperidin-3-yl-1,3-oxazole-4-carboxylate;hydrochloride
InChIKeyRDGKCHUZQLSGNN-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(OC=N1)C2CCCNC2.Cl

Computed by PubChem (NCBI)