CAS 1187929-24-3 appears in our catalog under these names: 2,4,6-Trimethoxybenzimidamide hydrochloride, 95+%, 2,4,6-Trimethoxybenzimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4,6-trimethoxybenzenecarboximidamide;hydrochloride (CAS 1187929-24-3) is a chemical compound with the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. IUPAC name: 2,4,6-trimethoxybenzenecarboximidamide;hydrochloride. InChIKey: QSFMJDXNKLGORI-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O3 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2,4,6-trimethoxybenzenecarboximidamide;hydrochloride |
| InChIKey | QSFMJDXNKLGORI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=N)N)OC.Cl |
Computed by PubChem (NCBI)