Products 2174008-22-9

CAS 2174008-22-9 is the registry number for Methyl 5-(piperidin-4-yl)-1,3-oxazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride (CAS 2174008-22-9) is a chemical compound with the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride. InChIKey: QDMFFZPPVGROOW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O3
Molecular weight246.69 g/mol
IUPAC namemethyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride
InChIKeyQDMFFZPPVGROOW-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(OC=N1)C2CCNCC2.Cl

Computed by PubChem (NCBI)