CAS 1172847-00-5 is the registry number for 5-Methyl-4-((pyrrolidin-1-yl)methyl)-1,2-oxazole-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-methyl-4-(pyrrolidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride (CAS 1172847-00-5) is a chemical compound with the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. IUPAC name: 5-methyl-4-(pyrrolidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride. InChIKey: LNPDDGZBTOXQJS-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O3 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 5-methyl-4-(pyrrolidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride |
| InChIKey | LNPDDGZBTOXQJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)CN2CCCC2.Cl |
Computed by PubChem (NCBI)