Products 234751-02-1
CAS 234751-02-1 appears in our catalog under these names: Methyl 4-(isopropylamino)-3-nitrobenzoate, 95%, 4–Isopropylamino–3–nitro–benzoic acid methyl ester, 4-Isopropylamino-3-nitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 3-nitro-4-(propan-2-ylamino)benzoate (CAS 234751-02-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: methyl 3-nitro-4-(propan-2-ylamino)benzoate. InChIKey: KDBFIMHBQVKQTJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | methyl 3-nitro-4-(propan-2-ylamino)benzoate |
| InChIKey | KDBFIMHBQVKQTJ-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)