Products 52663-87-3

CAS 52663-87-3 is the registry number for Ampholak YJH 40. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.

Structural formula: {0} (CAS {1})

3-[2-carboxyethyl(octyl)amino]propanoic acid (CAS 52663-87-3) is a chemical compound with the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. IUPAC name: 3-[2-carboxyethyl(octyl)amino]propanoic acid. InChIKey: YZMCEFRJPWTZMX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H27NO4
Molecular weight273.37 g/mol
IUPAC name3-[2-carboxyethyl(octyl)amino]propanoic acid
InChIKeyYZMCEFRJPWTZMX-UHFFFAOYSA-N
SMILESCCCCCCCCN(CCC(=O)O)CCC(=O)O

Computed by PubChem (NCBI)