Products 23513-72-6
CAS 23513-72-6 appears in our catalog under these names: 5-Oxo-L-proline 2-(Dimethylamino)ethanol, Deanol pidolate. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, Get quote.
2-(dimethylamino)ethanol;(2S)-5-oxopyrrolidine-2-carboxylic acid (CAS 23513-72-6) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: 2-(dimethylamino)ethanol;(2S)-5-oxopyrrolidine-2-carboxylic acid. InChIKey: DAEHWWVKPWBXGD-DFWYDOINSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-(dimethylamino)ethanol;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | DAEHWWVKPWBXGD-DFWYDOINSA-N |
| SMILES | CN(C)CCO.C1CC(=O)N[C@@H]1C(=O)O |
Computed by PubChem (NCBI)