Products 2351906-71-1
CAS 2351906-71-1 is the registry number for Cardiomyocyte proliferation promoting agent-1, 99.87%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 100 mg, 50 mg.
2-anilino-N-[(Z)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]propanamide (CAS 2351906-71-1) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: 2-anilino-N-[(Z)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]propanamide. InChIKey: RJHQUBJDRHLKEX-PGMHBOJBSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-anilino-N-[(Z)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]propanamide |
| InChIKey | RJHQUBJDRHLKEX-PGMHBOJBSA-N |
| SMILES | CC/C(=N/NC(=O)C(C)NC1=CC=CC=C1)/C2=C(C(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)