CAS 2354560-92-0 appears in our catalog under these names: Methyl (S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoate, 98%, Carbidopa Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoate (CAS 2354560-92-0) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoate. InChIKey: XPDPQUGQCOHVQQ-LBPRGKRZSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoate |
| InChIKey | XPDPQUGQCOHVQQ-LBPRGKRZSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)O)OC)(C(=O)OC)N |
Computed by PubChem (NCBI)