Products 2354583-07-4
CAS 2354583-07-4 is the registry number for 3-(3-Bromo-5-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-bromo-5-methoxyphenyl)-2-oxopropanoic acid (CAS 2354583-07-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 3-(3-bromo-5-methoxyphenyl)-2-oxopropanoic acid. InChIKey: NLZIXICBPCLNEN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 3-(3-bromo-5-methoxyphenyl)-2-oxopropanoic acid |
| InChIKey | NLZIXICBPCLNEN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)CC(=O)C(=O)O)Br |
Computed by PubChem (NCBI)