Products 2355652-50-3
CAS 2355652-50-3 is the registry number for 1-(3,6-Dimethoxypyridazin-4-yl)-2,2,2-trifluoroethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3,6-dimethoxypyridazin-4-yl)-2,2,2-trifluoroethanone (CAS 2355652-50-3) is a chemical compound with the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. IUPAC name: 1-(3,6-dimethoxypyridazin-4-yl)-2,2,2-trifluoroethanone. InChIKey: VCQHUOLRUYQEON-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O3 |
|---|---|
| Molecular weight | 236.15 g/mol |
| IUPAC name | 1-(3,6-dimethoxypyridazin-4-yl)-2,2,2-trifluoroethanone |
| InChIKey | VCQHUOLRUYQEON-UHFFFAOYSA-N |
| SMILES | COC1=NN=C(C(=C1)C(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)