CAS 2357116-00-6 is the registry number for 1-(2,6-Dioxopiperidin-3-yl)-3-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazole-5-carbaldehyde (CAS 2357116-00-6) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazole-5-carbaldehyde. InChIKey: KDNZECOGHUSLHG-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazole-5-carbaldehyde |
| InChIKey | KDNZECOGHUSLHG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C=O)N(C1=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)