Products 2925088-40-8
CAS 2925088-40-8 appears in our catalog under these names: 3-(2,6-dioxopiperidin-3-yl)-1-methyl-1H-indazole-7-carboxylic acid, 95%, 3-(2,6-Dioxopiperidin-3-yl)-1-methyl-1H-indazole-7-carboxylic acid, 96%, 96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-7-carboxylic acid (CAS 2925088-40-8) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-7-carboxylic acid. InChIKey: LTQLWCGJMSUTDR-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-7-carboxylic acid |
| InChIKey | LTQLWCGJMSUTDR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(=O)O)C(=N1)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)