CAS 2925071-04-9 appears in our catalog under these names: 3-(2,6-dioxopiperidin-3-yl)-1-methyl-1H-indazole-6-carboxylic acid, 95%, CRBN ligand-430. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-6-carboxylic acid (CAS 2925071-04-9) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-6-carboxylic acid. InChIKey: NISLCTBDAIILGX-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-3-yl)-1-methylindazole-6-carboxylic acid |
| InChIKey | NISLCTBDAIILGX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)O)C(=N1)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)