CAS 1468761-60-5 appears in our catalog under these names: Thalidomide-1-Me-5-NH2, 98.0%, 5-Amino-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%. Offered by: MedChemExpress, AmBeed. Available pack sizes: 25 mg, 100 mg, 50 mg, 250mg.
5-amino-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 1468761-60-5) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 5-amino-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: HLLSZPFRPIBHKB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 5-amino-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | HLLSZPFRPIBHKB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC(C1=O)N2C(=O)C3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)