Products 2766178-82-7
CAS 2766178-82-7 is the registry number for 2-(6-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1H-indol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indol-3-yl]acetic acid (CAS 2766178-82-7) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indol-3-yl]acetic acid. InChIKey: SDEQMBZQVZRIIA-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indol-3-yl]acetic acid |
| InChIKey | SDEQMBZQVZRIIA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)C(=CN3)CC(=O)O |
Computed by PubChem (NCBI)